About 2-amino-3-methylbutan-1-ol;1-aminopentan-2-ol
2-amino-3-methylbutan-1-ol;1-aminopentan-2-ol (PubChem CID 87877182) has the molecular formula C10H26N2O2
and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-amino-3-methylbutan-1-ol;1-aminopentan-2-ol.
Molecular Properties
| Compound Name | 2-amino-3-methylbutan-1-ol;1-aminopentan-2-ol |
| PubChem CID | 87877182 |
| Molecular Formula | C10H26N2O2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | 2-amino-3-methylbutan-1-ol;1-aminopentan-2-ol |
| SMILES | CC(C)C(N)CO.CCCC(O)CN |
| InChI | InChI=1S/2C5H13NO/c1-4(2)5(6)3-7;1-2-3-5(7)4-6/h4-5,7H,3,6H2,1-2H3;5,7H,2-4,6H2,1H3 |
| InChIKey | JCHUSZFRGYFOAD-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-3-methylbutan-1-ol;1-aminopentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-methylbutan-1-ol;1-aminopentan-2-ol?
The IUPAC name of 2-amino-3-methylbutan-1-ol;1-aminopentan-2-ol (CID 87877182) is 2-amino-3-methylbutan-1-ol;1-aminopentan-2-ol.
What is the SMILES notation for 2-amino-3-methylbutan-1-ol;1-aminopentan-2-ol?
The canonical SMILES for 2-amino-3-methylbutan-1-ol;1-aminopentan-2-ol is CC(C)C(N)CO.CCCC(O)CN.
What is the InChIKey of 2-amino-3-methylbutan-1-ol;1-aminopentan-2-ol?
The InChIKey is JCHUSZFRGYFOAD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H13NO/c1-4(2)5(6)3-7;1-2-3-5(7)4-6/h4-5,7H,3,6H2,1-2H3;5,7H,2-4,6H2,1H3.
What are the key properties of 2-amino-3-methylbutan-1-ol;1-aminopentan-2-ol?
2-amino-3-methylbutan-1-ol;1-aminopentan-2-ol has a molecular weight of 206.33 g/mol, XLogP of 0.07, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-methylbutan-1-ol;1-aminopentan-2-ol is sourced from PubChem (CID 87877182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).