C24H34N4O8S — CID 87877568
(3R)-3-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]propanoyl]amino]-5-oxopentanoic acid (PubChem CID 87877568) has the molecular formula C24H34N4O8S and a molecular weight of 538.62 g/mol. Its IUPAC name is (3R)-3-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]propanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (3R)-3-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]propanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 87877568 |
| Molecular Formula | C24H34N4O8S |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | (3R)-3-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylsulfanylbutanoyl]amino]propanoyl]amino]-5-oxopentanoic acid |
| SMILES | CSCC[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(C)=O)C(=O)N[C@@H](C)C(=O)N[C@H](CC=O)CC(=O)O |
| InChI | InChI=1S/C24H34N4O8S/c1-14(22(34)27-17(8-10-29)13-21(32)33)25-23(35)19(9-11-37-3)28-24(36)20(26-15(2)30)12-16-4-6-18(31)7-5-16/h4-7,10,14,17,19-20,31H,8-9,11-13H2,1-3H3,(H,25,35)(H,26,30)(H,27,34)(H,28,36)(H,32,33)/t14-,17+,19-,20-/m0/s1 |
| InChIKey | YUPJCOFNVZIUMI-KTGNWYGMSA-N |
| XLogP | -0.27 |
| TPSA | 191.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|