C23H26N2O2 — CID 87877733
(1R)-N-(cyanomethyl)-2-[2-(2-ethoxyphenyl)phenyl]cyclohexane-1-carboxamide (PubChem CID 87877733) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is (1R)-N-(cyanomethyl)-2-[2-(2-ethoxyphenyl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | (1R)-N-(cyanomethyl)-2-[2-(2-ethoxyphenyl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 87877733 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (1R)-N-(cyanomethyl)-2-[2-(2-ethoxyphenyl)phenyl]cyclohexane-1-carboxamide |
| SMILES | CCOc1ccccc1-c1ccccc1C1CCCC[C@H]1C(=O)NCC#N |
| InChI | InChI=1S/C23H26N2O2/c1-2-27-22-14-8-7-12-20(22)18-10-4-3-9-17(18)19-11-5-6-13-21(19)23(26)25-16-15-24/h3-4,7-10,12,14,19,21H,2,5-6,11,13,16H2,1H3,(H,25,26)/t19?,21-/m1/s1 |
| InChIKey | WOUIICMURSZJRD-VGAJERRHSA-N |
| XLogP | 4.67 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|