About 2-dimethoxyphosphinothioylsulfanyl-N-methylacetamide;phenol
2-dimethoxyphosphinothioylsulfanyl-N-methylacetamide;phenol (PubChem CID 87877864) has the molecular formula C11H18NO4PS2
and a molecular weight of 323.38 g/mol. Its IUPAC name is 2-dimethoxyphosphinothioylsulfanyl-N-methylacetamide;phenol.
Molecular Properties
| Compound Name | 2-dimethoxyphosphinothioylsulfanyl-N-methylacetamide;phenol |
| PubChem CID | 87877864 |
| Molecular Formula | C11H18NO4PS2 |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 2-dimethoxyphosphinothioylsulfanyl-N-methylacetamide;phenol |
| SMILES | CNC(=O)CSP(=S)(OC)OC.Oc1ccccc1 |
| InChI | InChI=1S/C6H6O.C5H12NO3PS2/c7-6-4-2-1-3-5-6;1-6-5(7)4-12-10(11,8-2)9-3/h1-5,7H;4H2,1-3H3,(H,6,7) |
| InChIKey | UTBUQEMPDKUQQV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-dimethoxyphosphinothioylsulfanyl-N-methylacetamide;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dimethoxyphosphinothioylsulfanyl-N-methylacetamide;phenol?
The IUPAC name of 2-dimethoxyphosphinothioylsulfanyl-N-methylacetamide;phenol (CID 87877864) is 2-dimethoxyphosphinothioylsulfanyl-N-methylacetamide;phenol.
What is the SMILES notation for 2-dimethoxyphosphinothioylsulfanyl-N-methylacetamide;phenol?
The canonical SMILES for 2-dimethoxyphosphinothioylsulfanyl-N-methylacetamide;phenol is CNC(=O)CSP(=S)(OC)OC.Oc1ccccc1.
What is the InChIKey of 2-dimethoxyphosphinothioylsulfanyl-N-methylacetamide;phenol?
The InChIKey is UTBUQEMPDKUQQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O.C5H12NO3PS2/c7-6-4-2-1-3-5-6;1-6-5(7)4-12-10(11,8-2)9-3/h1-5,7H;4H2,1-3H3,(H,6,7).
What are the key properties of 2-dimethoxyphosphinothioylsulfanyl-N-methylacetamide;phenol?
2-dimethoxyphosphinothioylsulfanyl-N-methylacetamide;phenol has a molecular weight of 323.38 g/mol, XLogP of 2.38, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dimethoxyphosphinothioylsulfanyl-N-methylacetamide;phenol is sourced from PubChem (CID 87877864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).