About [(3R,4S)-4-hydroxy-3-(2-methylbenzoyl)-2,5-dioxooxolan-3-yl] 2-methylbenzoate
[(3R,4S)-4-hydroxy-3-(2-methylbenzoyl)-2,5-dioxooxolan-3-yl] 2-methylbenzoate (PubChem CID 87878378) has the molecular formula C20H16O7
and a molecular weight of 368.34 g/mol. Its IUPAC name is [(3R,4S)-4-hydroxy-3-(2-methylbenzoyl)-2,5-dioxooxolan-3-yl] 2-methylbenzoate.
Molecular Properties
| Compound Name | [(3R,4S)-4-hydroxy-3-(2-methylbenzoyl)-2,5-dioxooxolan-3-yl] 2-methylbenzoate |
| PubChem CID | 87878378 |
| Molecular Formula | C20H16O7 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [(3R,4S)-4-hydroxy-3-(2-methylbenzoyl)-2,5-dioxooxolan-3-yl] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)O[C@]1(C(=O)c2ccccc2C)C(=O)OC(=O)[C@H]1O |
| InChI | InChI=1S/C20H16O7/c1-11-7-3-5-9-13(11)15(21)20(16(22)18(24)26-19(20)25)27-17(23)14-10-6-4-8-12(14)2/h3-10,16,22H,1-2H3/t16-,20+/m1/s1 |
| InChIKey | YBVBTBUISQEULE-UZLBHIALSA-N |
| XLogP | 1.53 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [(3R,4S)-4-hydroxy-3-(2-methylbenzoyl)-2,5-dioxooxolan-3-yl] 2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-4-hydroxy-3-(2-methylbenzoyl)-2,5-dioxooxolan-3-yl] 2-methylbenzoate?
The IUPAC name of [(3R,4S)-4-hydroxy-3-(2-methylbenzoyl)-2,5-dioxooxolan-3-yl] 2-methylbenzoate (CID 87878378) is [(3R,4S)-4-hydroxy-3-(2-methylbenzoyl)-2,5-dioxooxolan-3-yl] 2-methylbenzoate.
What is the SMILES notation for [(3R,4S)-4-hydroxy-3-(2-methylbenzoyl)-2,5-dioxooxolan-3-yl] 2-methylbenzoate?
The canonical SMILES for [(3R,4S)-4-hydroxy-3-(2-methylbenzoyl)-2,5-dioxooxolan-3-yl] 2-methylbenzoate is Cc1ccccc1C(=O)O[C@]1(C(=O)c2ccccc2C)C(=O)OC(=O)[C@H]1O.
What is the InChIKey of [(3R,4S)-4-hydroxy-3-(2-methylbenzoyl)-2,5-dioxooxolan-3-yl] 2-methylbenzoate?
The InChIKey is YBVBTBUISQEULE-UZLBHIALSA-N. The full InChI is InChI=1S/C20H16O7/c1-11-7-3-5-9-13(11)15(21)20(16(22)18(24)26-19(20)25)27-17(23)14-10-6-4-8-12(14)2/h3-10,16,22H,1-2H3/t16-,20+/m1/s1.
What are the key properties of [(3R,4S)-4-hydroxy-3-(2-methylbenzoyl)-2,5-dioxooxolan-3-yl] 2-methylbenzoate?
[(3R,4S)-4-hydroxy-3-(2-methylbenzoyl)-2,5-dioxooxolan-3-yl] 2-methylbenzoate has a molecular weight of 368.34 g/mol, XLogP of 1.53, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-4-hydroxy-3-(2-methylbenzoyl)-2,5-dioxooxolan-3-yl] 2-methylbenzoate is sourced from PubChem (CID 87878378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).