About zinc bis(N-[(2,3-dipropylphenyl)disulfanyl]carbamate)
zinc bis(N-[(2,3-dipropylphenyl)disulfanyl]carbamate) (PubChem CID 87878446) has the molecular formula C26H36N2O4S4Zn
and a molecular weight of 634.24 g/mol. Its IUPAC name is zinc bis(N-[(2,3-dipropylphenyl)disulfanyl]carbamate).
Molecular Properties
| Compound Name | zinc bis(N-[(2,3-dipropylphenyl)disulfanyl]carbamate) |
| PubChem CID | 87878446 |
| Molecular Formula | C26H36N2O4S4Zn |
| Molecular Weight | 634.24 g/mol |
| Exact Mass | 632.08 |
| IUPAC Name | zinc bis(N-[(2,3-dipropylphenyl)disulfanyl]carbamate) |
| SMILES | CCCc1cccc(SSNC(=O)[O-])c1CCC.CCCc1cccc(SSNC(=O)[O-])c1CCC.[Zn+2] |
| InChI | InChI=1S/2C13H19NO2S2.Zn/c2*1-3-6-10-8-5-9-12(11(10)7-4-2)17-18-14-13(15)16;/h2*5,8-9,14H,3-4,6-7H2,1-2H3,(H,15,16);/q;;+2/p-2 |
| InChIKey | SZGMHXVIRLFOCR-UHFFFAOYSA-L |
| XLogP | 6.36 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 634.24 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(N-[(2,3-dipropylphenyl)disulfanyl]carbamate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(N-[(2,3-dipropylphenyl)disulfanyl]carbamate)?
The IUPAC name of zinc bis(N-[(2,3-dipropylphenyl)disulfanyl]carbamate) (CID 87878446) is zinc bis(N-[(2,3-dipropylphenyl)disulfanyl]carbamate).
What is the SMILES notation for zinc bis(N-[(2,3-dipropylphenyl)disulfanyl]carbamate)?
The canonical SMILES for zinc bis(N-[(2,3-dipropylphenyl)disulfanyl]carbamate) is CCCc1cccc(SSNC(=O)[O-])c1CCC.CCCc1cccc(SSNC(=O)[O-])c1CCC.[Zn+2].
What is the InChIKey of zinc bis(N-[(2,3-dipropylphenyl)disulfanyl]carbamate)?
The InChIKey is SZGMHXVIRLFOCR-UHFFFAOYSA-L. The full InChI is InChI=1S/2C13H19NO2S2.Zn/c2*1-3-6-10-8-5-9-12(11(10)7-4-2)17-18-14-13(15)16;/h2*5,8-9,14H,3-4,6-7H2,1-2H3,(H,15,16);/q;;+2/p-2.
What are the key properties of zinc bis(N-[(2,3-dipropylphenyl)disulfanyl]carbamate)?
zinc bis(N-[(2,3-dipropylphenyl)disulfanyl]carbamate) has a molecular weight of 634.24 g/mol, XLogP of 6.36, 14 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(N-[(2,3-dipropylphenyl)disulfanyl]carbamate) is sourced from PubChem (CID 87878446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).