About 1H-diazete-2-carboxylic acid;molybdenum
1H-diazete-2-carboxylic acid;molybdenum (PubChem CID 87878776) has the molecular formula C3H4MoN2O2
and a molecular weight of 196.02 g/mol. Its IUPAC name is 1H-diazete-2-carboxylic acid;molybdenum.
Molecular Properties
| Compound Name | 1H-diazete-2-carboxylic acid;molybdenum |
| PubChem CID | 87878776 |
| Molecular Formula | C3H4MoN2O2 |
| Molecular Weight | 196.02 g/mol |
| Exact Mass | 197.93 |
| IUPAC Name | 1H-diazete-2-carboxylic acid;molybdenum |
| SMILES | O=C(O)n1cc[nH]1.[Mo] |
| InChI | InChI=1S/C3H4N2O2.Mo/c6-3(7)5-2-1-4-5;/h1-2,4H,(H,6,7); |
| InChIKey | CXHBKHAQIAJJFV-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.02 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-diazete-2-carboxylic acid;molybdenum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-diazete-2-carboxylic acid;molybdenum?
The IUPAC name of 1H-diazete-2-carboxylic acid;molybdenum (CID 87878776) is 1H-diazete-2-carboxylic acid;molybdenum.
What is the SMILES notation for 1H-diazete-2-carboxylic acid;molybdenum?
The canonical SMILES for 1H-diazete-2-carboxylic acid;molybdenum is O=C(O)n1cc[nH]1.[Mo].
What is the InChIKey of 1H-diazete-2-carboxylic acid;molybdenum?
The InChIKey is CXHBKHAQIAJJFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O2.Mo/c6-3(7)5-2-1-4-5;/h1-2,4H,(H,6,7);.
What are the key properties of 1H-diazete-2-carboxylic acid;molybdenum?
1H-diazete-2-carboxylic acid;molybdenum has a molecular weight of 196.02 g/mol, XLogP of 0.34, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-diazete-2-carboxylic acid;molybdenum is sourced from PubChem (CID 87878776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).