C48H40Br6N2NiO4 — CID 87878787
1-N,2-N-bis[2,6-di(propan-2-yl)phenyl]acenaphthylene-1,2-diimine;1,4,6,7,8,9-hexabromodibenzo-p-dioxin-2,3-diolate;nickel(2+) (PubChem CID 87878787) has the molecular formula C48H40Br6N2NiO4 and a molecular weight of 1246.97 g/mol. Its IUPAC name is 1-N,2-N-bis[2,6-di(propan-2-yl)phenyl]acenaphthylene-1,2-diimine;1,4,6,7,8,9-hexabromodibenzo-p-dioxin-2,3-diolate;nickel(2+).
| Compound Name | 1-N,2-N-bis[2,6-di(propan-2-yl)phenyl]acenaphthylene-1,2-diimine;1,4,6,7,8,9-hexabromodibenzo-p-dioxin-2,3-diolate;nickel(2+) |
|---|---|
| PubChem CID | 87878787 |
| Molecular Formula | C48H40Br6N2NiO4 |
| Molecular Weight | 1246.97 g/mol |
| Exact Mass | 1239.74 |
| IUPAC Name | 1-N,2-N-bis[2,6-di(propan-2-yl)phenyl]acenaphthylene-1,2-diimine;1,4,6,7,8,9-hexabromodibenzo-p-dioxin-2,3-diolate;nickel(2+) |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C1C(=N/c2c(C(C)C)cccc2C(C)C)/c2cccc3cccc/1c23.[Ni+2].[O-]c1c([O-])c(Br)c2c(c1Br)Oc1c(Br)c(Br)c(Br)c(Br)c1O2 |
| InChI | InChI=1S/C36H40N2.C12H2Br6O4.Ni/c1-21(2)26-15-11-16-27(22(3)4)33(26)37-35-30-19-9-13-25-14-10-20-31(32(25)30)36(35)38-34-28(23(5)6)17-12-18-29(34)24(7)8;13-1-2(14)4(16)10-9(3(1)15)21-11-5(17)7(19)8(20)6(18)12(11)22-10;/h9-24H,1-8H3;19-20H;/q;;+2/p-2/b37-35+,38-36+;; |
| InChIKey | NRMBOGDYXUXBSP-HKXUKFGYSA-L |
| XLogP | 16.89 |
| TPSA | 89.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1246.97 |
| LogP ≤ 5 | 16.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|