C52H104N2O2 — CID 87879456
(Z)-3-[(9Z,12Z)-2-[1-(diethylamino)ethyl]octadeca-9,12-dienoxy]-N,N-diethylicos-11-en-1-amine;ethoxyethane (PubChem CID 87879456) has the molecular formula C52H104N2O2 and a molecular weight of 789.42 g/mol. Its IUPAC name is (Z)-3-[(9Z,12Z)-2-[1-(diethylamino)ethyl]octadeca-9,12-dienoxy]-N,N-diethylicos-11-en-1-amine;ethoxyethane.
| Compound Name | (Z)-3-[(9Z,12Z)-2-[1-(diethylamino)ethyl]octadeca-9,12-dienoxy]-N,N-diethylicos-11-en-1-amine;ethoxyethane |
|---|---|
| PubChem CID | 87879456 |
| Molecular Formula | C52H104N2O2 |
| Molecular Weight | 789.42 g/mol |
| Exact Mass | 788.81 |
| IUPAC Name | (Z)-3-[(9Z,12Z)-2-[1-(diethylamino)ethyl]octadeca-9,12-dienoxy]-N,N-diethylicos-11-en-1-amine;ethoxyethane |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCC(COC(CCCCCCC/C=C\CCCCCCCC)CCN(CC)CC)C(C)N(CC)CC.CCOCC |
| InChI | InChI=1S/C48H94N2O.C4H10O/c1-8-14-16-18-20-22-24-26-28-30-32-34-36-38-40-42-48(43-44-49(10-3)11-4)51-45-47(46(7)50(12-5)13-6)41-39-37-35-33-31-29-27-25-23-21-19-17-15-9-2;1-3-5-4-2/h21,23,26-29,46-48H,8-20,22,24-25,30-45H2,1-7H3;3-4H2,1-2H3/b23-21-,28-26-,29-27-; |
| InChIKey | AFXLJRBQFGTTNS-OKEAAYEDSA-N |
| XLogP | 15.95 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.42 |
| LogP ≤ 5 | 15.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|