C16H13NS — CID 87879566
13-thia-3-azatetracyclo[9.7.0.02,7.012,17]octadeca-1,5,7,9,11,14,16-heptaene (PubChem CID 87879566) has the molecular formula C16H13NS and a molecular weight of 251.35 g/mol. Its IUPAC name is 13-thia-3-azatetracyclo[9.7.0.02,7.012,17]octadeca-1,5,7,9,11,14,16-heptaene.
| Compound Name | 13-thia-3-azatetracyclo[9.7.0.02,7.012,17]octadeca-1,5,7,9,11,14,16-heptaene |
|---|---|
| PubChem CID | 87879566 |
| Molecular Formula | C16H13NS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 13-thia-3-azatetracyclo[9.7.0.02,7.012,17]octadeca-1,5,7,9,11,14,16-heptaene |
| SMILES | C1=CSC2=C3C=CC=C4C=CCNC4=C3CC2=C1 |
| InChI | InChI=1S/C16H13NS/c1-4-11-5-2-8-17-15(11)14-10-12-6-3-9-18-16(12)13(14)7-1/h1-7,9,17H,8,10H2 |
| InChIKey | SLFTVPLUKVXEQJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |