C6H3F11O2 — CID 87879584
1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pentane-2,3-diol (PubChem CID 87879584) has the molecular formula C6H3F11O2 and a molecular weight of 316.07 g/mol. Its IUPAC name is 1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pentane-2,3-diol.
| Compound Name | 1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pentane-2,3-diol |
|---|---|
| PubChem CID | 87879584 |
| Molecular Formula | C6H3F11O2 |
| Molecular Weight | 316.07 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pentane-2,3-diol |
| SMILES | OC(C(F)(F)C(F)(F)F)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H3F11O2/c7-3(8,6(15,16)17)1(18)2(19,4(9,10)11)5(12,13)14/h1,18-19H |
| InChIKey | PNTSHQIPMPJVMU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.07 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|