7H-indeno[2,1-c]pyridine-4-carboxylic acid

C13H9NO2 — CID 87879625

IUPAC7H-indeno[2,1-c]pyridine-4-carboxylic acid
SMILESO=C(O)c1cncc2c1=C1C=CCC=C1C=2
InChIInChI=1S/C13H9NO2/c15-13(16)11-7-14-6-9-5-8-3-1-2-4-10(8)12(9)11/h2-7H,1H2,(H,15,16)
InChIKeyABOPIXQYIVRQQX-UHFFFAOYSA-N
MW211.22 g/mol
LogP0.61
Rot. Bonds1

About 7H-indeno[2,1-c]pyridine-4-carboxylic acid

7H-indeno[2,1-c]pyridine-4-carboxylic acid (PubChem CID 87879625) has the molecular formula C13H9NO2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 7H-indeno[2,1-c]pyridine-4-carboxylic acid.

Molecular Properties

Compound Name7H-indeno[2,1-c]pyridine-4-carboxylic acid
PubChem CID87879625
Molecular FormulaC13H9NO2
Molecular Weight211.22 g/mol
Exact Mass211.06
IUPAC Name7H-indeno[2,1-c]pyridine-4-carboxylic acid
SMILESO=C(O)c1cncc2c1=C1C=CCC=C1C=2
InChIInChI=1S/C13H9NO2/c15-13(16)11-7-14-6-9-5-8-3-1-2-4-10(8)12(9)11/h2-7H,1H2,(H,15,16)
InChIKeyABOPIXQYIVRQQX-UHFFFAOYSA-N
XLogP0.61
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.22
LogP ≤ 50.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 7H-indeno[2,1-c]pyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7H-indeno[2,1-c]pyridine-4-carboxylic acid?
The IUPAC name of 7H-indeno[2,1-c]pyridine-4-carboxylic acid (CID 87879625) is 7H-indeno[2,1-c]pyridine-4-carboxylic acid.
What is the SMILES notation for 7H-indeno[2,1-c]pyridine-4-carboxylic acid?
The canonical SMILES for 7H-indeno[2,1-c]pyridine-4-carboxylic acid is O=C(O)c1cncc2c1=C1C=CCC=C1C=2.
What is the InChIKey of 7H-indeno[2,1-c]pyridine-4-carboxylic acid?
The InChIKey is ABOPIXQYIVRQQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO2/c15-13(16)11-7-14-6-9-5-8-3-1-2-4-10(8)12(9)11/h2-7H,1H2,(H,15,16).
What are the key properties of 7H-indeno[2,1-c]pyridine-4-carboxylic acid?
7H-indeno[2,1-c]pyridine-4-carboxylic acid has a molecular weight of 211.22 g/mol, XLogP of 0.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-indeno[2,1-c]pyridine-4-carboxylic acid is sourced from PubChem (CID 87879625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).