C10H8F10O — CID 87879724
1,1,2,2,3-pentafluoro-3-[1-[1-(1,2,2,3,3-pentafluorocyclopropyl)ethoxy]ethyl]cyclopropane (PubChem CID 87879724) has the molecular formula C10H8F10O and a molecular weight of 334.15 g/mol. Its IUPAC name is 1,1,2,2,3-pentafluoro-3-[1-[1-(1,2,2,3,3-pentafluorocyclopropyl)ethoxy]ethyl]cyclopropane.
| Compound Name | 1,1,2,2,3-pentafluoro-3-[1-[1-(1,2,2,3,3-pentafluorocyclopropyl)ethoxy]ethyl]cyclopropane |
|---|---|
| PubChem CID | 87879724 |
| Molecular Formula | C10H8F10O |
| Molecular Weight | 334.15 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 1,1,2,2,3-pentafluoro-3-[1-[1-(1,2,2,3,3-pentafluorocyclopropyl)ethoxy]ethyl]cyclopropane |
| SMILES | CC(OC(C)C1(F)C(F)(F)C1(F)F)C1(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H8F10O/c1-3(5(11)7(13,14)8(5,15)16)21-4(2)6(12)9(17,18)10(6,19)20/h3-4H,1-2H3 |
| InChIKey | FBYXXJGPFBBJNL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.15 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|