C21H27F5O3 — CID 87879910
(8S,9R,10R,13S,14S)-11,17-dihydroxy-10,13-dimethyl-17-(1,1,2,2,2-pentafluoroethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 87879910) has the molecular formula C21H27F5O3 and a molecular weight of 422.43 g/mol. Its IUPAC name is (8S,9R,10R,13S,14S)-11,17-dihydroxy-10,13-dimethyl-17-(1,1,2,2,2-pentafluoroethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10R,13S,14S)-11,17-dihydroxy-10,13-dimethyl-17-(1,1,2,2,2-pentafluoroethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 87879910 |
| Molecular Formula | C21H27F5O3 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (8S,9R,10R,13S,14S)-11,17-dihydroxy-10,13-dimethyl-17-(1,1,2,2,2-pentafluoroethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@H]2C(O)C[C@@]2(C)[C@H]1CCC2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H27F5O3/c1-17-7-5-12(27)9-11(17)3-4-13-14-6-8-19(29,20(22,23)21(24,25)26)18(14,2)10-15(28)16(13)17/h9,13-16,28-29H,3-8,10H2,1-2H3/t13-,14-,15?,16-,17-,18-,19?/m0/s1 |
| InChIKey | RKJCSUCKIFGUIR-OEFMGZHFSA-N |
| XLogP | 4.42 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|