C7H7N2O+ — CID 87880044
1-azoniacyclohepta-1,3,5,7-tetraene-4-carboxamide (PubChem CID 87880044) has the molecular formula C7H7N2O+ and a molecular weight of 135.15 g/mol. Its IUPAC name is 1-azoniacyclohepta-1,3,5,7-tetraene-4-carboxamide.
| Compound Name | 1-azoniacyclohepta-1,3,5,7-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 87880044 |
| Molecular Formula | C7H7N2O+ |
| Molecular Weight | 135.15 g/mol |
| Exact Mass | 135.06 |
| IUPAC Name | 1-azoniacyclohepta-1,3,5,7-tetraene-4-carboxamide |
| SMILES | NC(=O)C1=CC=[N+]=CC=C1 |
| InChI | InChI=1S/C7H6N2O/c8-7(10)6-2-1-4-9-5-3-6/h1-5H,(H-,8,10)/p+1 |
| InChIKey | VTLYOYMOZQHEAD-UHFFFAOYSA-O |
| XLogP | -0.82 |
| TPSA | 57.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.15 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|