About N'-(2-amino-1,2-dicyanoethenyl)-2-methylpropanimidamide;hydrochloride
N'-(2-amino-1,2-dicyanoethenyl)-2-methylpropanimidamide;hydrochloride (PubChem CID 87880330) has the molecular formula C8H12ClN5
and a molecular weight of 213.67 g/mol. Its IUPAC name is N'-(2-amino-1,2-dicyanoethenyl)-2-methylpropanimidamide;hydrochloride.
Molecular Properties
| Compound Name | N'-(2-amino-1,2-dicyanoethenyl)-2-methylpropanimidamide;hydrochloride |
| PubChem CID | 87880330 |
| Molecular Formula | C8H12ClN5 |
| Molecular Weight | 213.67 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | N'-(2-amino-1,2-dicyanoethenyl)-2-methylpropanimidamide;hydrochloride |
| SMILES | CC(C)/C(N)=N\C(C#N)=C(N)C#N.Cl |
| InChI | InChI=1S/C8H11N5.ClH/c1-5(2)8(12)13-7(4-10)6(11)3-9;/h5H,11H2,1-2H3,(H2,12,13);1H |
| InChIKey | UAWZLLWUJFJMLT-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.67 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-amino-1,2-dicyanoethenyl)-2-methylpropanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-amino-1,2-dicyanoethenyl)-2-methylpropanimidamide;hydrochloride?
The IUPAC name of N'-(2-amino-1,2-dicyanoethenyl)-2-methylpropanimidamide;hydrochloride (CID 87880330) is N'-(2-amino-1,2-dicyanoethenyl)-2-methylpropanimidamide;hydrochloride.
What is the SMILES notation for N'-(2-amino-1,2-dicyanoethenyl)-2-methylpropanimidamide;hydrochloride?
The canonical SMILES for N'-(2-amino-1,2-dicyanoethenyl)-2-methylpropanimidamide;hydrochloride is CC(C)/C(N)=N\C(C#N)=C(N)C#N.Cl.
What is the InChIKey of N'-(2-amino-1,2-dicyanoethenyl)-2-methylpropanimidamide;hydrochloride?
The InChIKey is UAWZLLWUJFJMLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5.ClH/c1-5(2)8(12)13-7(4-10)6(11)3-9;/h5H,11H2,1-2H3,(H2,12,13);1H.
What are the key properties of N'-(2-amino-1,2-dicyanoethenyl)-2-methylpropanimidamide;hydrochloride?
N'-(2-amino-1,2-dicyanoethenyl)-2-methylpropanimidamide;hydrochloride has a molecular weight of 213.67 g/mol, XLogP of 0.64, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-amino-1,2-dicyanoethenyl)-2-methylpropanimidamide;hydrochloride is sourced from PubChem (CID 87880330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).