C14H22O5 — CID 87880433
3-[3-(1,2-dihydroxyethyl)penta-1,4-dien-3-yloxy]-3-ethenylpent-4-ene-1,2-diol (PubChem CID 87880433) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is 3-[3-(1,2-dihydroxyethyl)penta-1,4-dien-3-yloxy]-3-ethenylpent-4-ene-1,2-diol.
| Compound Name | 3-[3-(1,2-dihydroxyethyl)penta-1,4-dien-3-yloxy]-3-ethenylpent-4-ene-1,2-diol |
|---|---|
| PubChem CID | 87880433 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 3-[3-(1,2-dihydroxyethyl)penta-1,4-dien-3-yloxy]-3-ethenylpent-4-ene-1,2-diol |
| SMILES | C=CC(C=C)(OC(C=C)(C=C)C(O)CO)C(O)CO |
| InChI | InChI=1S/C14H22O5/c1-5-13(6-2,11(17)9-15)19-14(7-3,8-4)12(18)10-16/h5-8,11-12,15-18H,1-4,9-10H2 |
| InChIKey | OIVCGEWMXPEFPQ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|