About 2-bromo-6-chloro-4-(1-chloropropan-2-ylidene)octa-1,6-diene
2-bromo-6-chloro-4-(1-chloropropan-2-ylidene)octa-1,6-diene (PubChem CID 87880865) has the molecular formula C11H15BrCl2
and a molecular weight of 298.05 g/mol. Its IUPAC name is 2-bromo-6-chloro-4-(1-chloropropan-2-ylidene)octa-1,6-diene.
Molecular Properties
| Compound Name | 2-bromo-6-chloro-4-(1-chloropropan-2-ylidene)octa-1,6-diene |
| PubChem CID | 87880865 |
| Molecular Formula | C11H15BrCl2 |
| Molecular Weight | 298.05 g/mol |
| Exact Mass | 295.97 |
| IUPAC Name | 2-bromo-6-chloro-4-(1-chloropropan-2-ylidene)octa-1,6-diene |
| SMILES | C=C(Br)CC(CC(Cl)=CC)=C(C)CCl |
| InChI | InChI=1S/C11H15BrCl2/c1-4-11(14)6-10(5-9(3)12)8(2)7-13/h4H,3,5-7H2,1-2H3 |
| InChIKey | COPWGLGXKMOJCN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.05 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-chloro-4-(1-chloropropan-2-ylidene)octa-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-chloro-4-(1-chloropropan-2-ylidene)octa-1,6-diene?
The IUPAC name of 2-bromo-6-chloro-4-(1-chloropropan-2-ylidene)octa-1,6-diene (CID 87880865) is 2-bromo-6-chloro-4-(1-chloropropan-2-ylidene)octa-1,6-diene.
What is the SMILES notation for 2-bromo-6-chloro-4-(1-chloropropan-2-ylidene)octa-1,6-diene?
The canonical SMILES for 2-bromo-6-chloro-4-(1-chloropropan-2-ylidene)octa-1,6-diene is C=C(Br)CC(CC(Cl)=CC)=C(C)CCl.
What is the InChIKey of 2-bromo-6-chloro-4-(1-chloropropan-2-ylidene)octa-1,6-diene?
The InChIKey is COPWGLGXKMOJCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrCl2/c1-4-11(14)6-10(5-9(3)12)8(2)7-13/h4H,3,5-7H2,1-2H3.
What are the key properties of 2-bromo-6-chloro-4-(1-chloropropan-2-ylidene)octa-1,6-diene?
2-bromo-6-chloro-4-(1-chloropropan-2-ylidene)octa-1,6-diene has a molecular weight of 298.05 g/mol, XLogP of 5.37, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-chloro-4-(1-chloropropan-2-ylidene)octa-1,6-diene is sourced from PubChem (CID 87880865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).