About N,N-dimethylcyclopenta-1,3-dien-1-amine;zirconium
N,N-dimethylcyclopenta-1,3-dien-1-amine;zirconium (PubChem CID 87881044) has the molecular formula C7H11NZr
and a molecular weight of 200.40 g/mol. Its IUPAC name is N,N-dimethylcyclopenta-1,3-dien-1-amine;zirconium.
Molecular Properties
| Compound Name | N,N-dimethylcyclopenta-1,3-dien-1-amine;zirconium |
| PubChem CID | 87881044 |
| Molecular Formula | C7H11NZr |
| Molecular Weight | 200.40 g/mol |
| Exact Mass | 198.99 |
| IUPAC Name | N,N-dimethylcyclopenta-1,3-dien-1-amine;zirconium |
| SMILES | CN(C)C1=CC=CC1.[Zr] |
| InChI | InChI=1S/C7H11N.Zr/c1-8(2)7-5-3-4-6-7;/h3-5H,6H2,1-2H3; |
| InChIKey | PKJMOTOLINYKIN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylcyclopenta-1,3-dien-1-amine;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylcyclopenta-1,3-dien-1-amine;zirconium?
The IUPAC name of N,N-dimethylcyclopenta-1,3-dien-1-amine;zirconium (CID 87881044) is N,N-dimethylcyclopenta-1,3-dien-1-amine;zirconium.
What is the SMILES notation for N,N-dimethylcyclopenta-1,3-dien-1-amine;zirconium?
The canonical SMILES for N,N-dimethylcyclopenta-1,3-dien-1-amine;zirconium is CN(C)C1=CC=CC1.[Zr].
What is the InChIKey of N,N-dimethylcyclopenta-1,3-dien-1-amine;zirconium?
The InChIKey is PKJMOTOLINYKIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N.Zr/c1-8(2)7-5-3-4-6-7;/h3-5H,6H2,1-2H3;.
What are the key properties of N,N-dimethylcyclopenta-1,3-dien-1-amine;zirconium?
N,N-dimethylcyclopenta-1,3-dien-1-amine;zirconium has a molecular weight of 200.40 g/mol, XLogP of 1.39, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylcyclopenta-1,3-dien-1-amine;zirconium is sourced from PubChem (CID 87881044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).