About CID 87881562
CID 87881562 (PubChem CID 87881562) has the molecular formula C52H55AsN9O8S
and a molecular weight of 1041.06 g/mol.
Molecular Properties
| Compound Name | CID 87881562 |
| PubChem CID | 87881562 |
| Molecular Formula | C52H55AsN9O8S |
| Molecular Weight | 1041.06 g/mol |
| Exact Mass | 1040.31 |
| IUPAC Name | — |
| SMILES | CCOc1cc2ncc(C(N)=O)c(Nc3cccc(CNCc4ccsc4)c3CC)c2cc1OCC.CCc1c(Cn2cnc([N+](=O)[O-])c2)cccc1[As]c1c(C(N)=O)cnc2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C28H32N4O3S.C24H23AsN5O5/c1-4-20-19(15-30-14-18-10-11-36-17-18)8-7-9-23(20)32-27-21-12-25(34-5-2)26(35-6-3)13-24(21)31-16-22(27)28(29)33;1-4-15-14(11-29-12-22(28-13-29)30(32)33)6-5-7-18(15)25-23-16-8-20(34-2)21(35-3)9-19(16)27-10-17(23)24(26)31/h7-13,16-17,30H,4-6,14-15H2,1-3H3,(H2,29,33)(H,31,32);5-10,12-13H,4,11H2,1-3H3,(H2,26,31) |
| InChIKey | RRXAYEUMSIDNLZ-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 233.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 71 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1041.06 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 87881562 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87881562?
The IUPAC name of CID 87881562 (CID 87881562) is not available.
What is the SMILES notation for CID 87881562?
The canonical SMILES for CID 87881562 is CCOc1cc2ncc(C(N)=O)c(Nc3cccc(CNCc4ccsc4)c3CC)c2cc1OCC.CCc1c(Cn2cnc([N+](=O)[O-])c2)cccc1[As]c1c(C(N)=O)cnc2cc(OC)c(OC)cc12.
What is the InChIKey of CID 87881562?
The InChIKey is RRXAYEUMSIDNLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H32N4O3S.C24H23AsN5O5/c1-4-20-19(15-30-14-18-10-11-36-17-18)8-7-9-23(20)32-27-21-12-25(34-5-2)26(35-6-3)13-24(21)31-16-22(27)28(29)33;1-4-15-14(11-29-12-22(28-13-29)30(32)33)6-5-7-18(15)25-23-16-8-20(34-2)21(35-3)9-19(16)27-10-17(23)24(26)31/h7-13,16-17,30H,4-6,14-15H2,1-3H3,(H2,29,33)(H,31,32);5-10,12-13H,4,11H2,1-3H3,(H2,26,31).
What are the key properties of CID 87881562?
CID 87881562 has a molecular weight of 1041.06 g/mol, XLogP of 7.51, 21 rotatable bonds, 4 hydrogen bond donors, and 15 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87881562 is sourced from PubChem (CID 87881562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).