About [4-(2-amino-2-methylpropyl)phenyl]azanide;palladium
[4-(2-amino-2-methylpropyl)phenyl]azanide;palladium (PubChem CID 87881678) has the molecular formula C10H15N2Pd-
and a molecular weight of 269.66 g/mol. Its IUPAC name is [4-(2-amino-2-methylpropyl)phenyl]azanide;palladium.
Molecular Properties
| Compound Name | [4-(2-amino-2-methylpropyl)phenyl]azanide;palladium |
| PubChem CID | 87881678 |
| Molecular Formula | C10H15N2Pd- |
| Molecular Weight | 269.66 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | [4-(2-amino-2-methylpropyl)phenyl]azanide;palladium |
| SMILES | CC(C)(N)Cc1ccc([NH-])cc1.[Pd] |
| InChI | InChI=1S/C10H15N2.Pd/c1-10(2,12)7-8-3-5-9(11)6-4-8;/h3-6,11H,7,12H2,1-2H3;/q-1; |
| InChIKey | SLIOKFZHVWLRQH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.66 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [4-(2-amino-2-methylpropyl)phenyl]azanide;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-amino-2-methylpropyl)phenyl]azanide;palladium?
The IUPAC name of [4-(2-amino-2-methylpropyl)phenyl]azanide;palladium (CID 87881678) is [4-(2-amino-2-methylpropyl)phenyl]azanide;palladium.
What is the SMILES notation for [4-(2-amino-2-methylpropyl)phenyl]azanide;palladium?
The canonical SMILES for [4-(2-amino-2-methylpropyl)phenyl]azanide;palladium is CC(C)(N)Cc1ccc([NH-])cc1.[Pd].
What is the InChIKey of [4-(2-amino-2-methylpropyl)phenyl]azanide;palladium?
The InChIKey is SLIOKFZHVWLRQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N2.Pd/c1-10(2,12)7-8-3-5-9(11)6-4-8;/h3-6,11H,7,12H2,1-2H3;/q-1;.
What are the key properties of [4-(2-amino-2-methylpropyl)phenyl]azanide;palladium?
[4-(2-amino-2-methylpropyl)phenyl]azanide;palladium has a molecular weight of 269.66 g/mol, XLogP of 2.65, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-amino-2-methylpropyl)phenyl]azanide;palladium is sourced from PubChem (CID 87881678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).