C17H31N3O2S — CID 87882419
(2S)-2-(cyclohexylamino)pentanoic acid;5-propan-2-yl-1,3-thiazol-2-amine (PubChem CID 87882419) has the molecular formula C17H31N3O2S and a molecular weight of 341.52 g/mol. Its IUPAC name is (2S)-2-(cyclohexylamino)pentanoic acid;5-propan-2-yl-1,3-thiazol-2-amine.
| Compound Name | (2S)-2-(cyclohexylamino)pentanoic acid;5-propan-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 87882419 |
| Molecular Formula | C17H31N3O2S |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (2S)-2-(cyclohexylamino)pentanoic acid;5-propan-2-yl-1,3-thiazol-2-amine |
| SMILES | CC(C)c1cnc(N)s1.CCC[C@H](NC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C11H21NO2.C6H10N2S/c1-2-6-10(11(13)14)12-9-7-4-3-5-8-9;1-4(2)5-3-8-6(7)9-5/h9-10,12H,2-8H2,1H3,(H,13,14);3-4H,1-2H3,(H2,7,8)/t10-;/m0./s1 |
| InChIKey | JCBIWORGJDDGAA-PPHPATTJSA-N |
| XLogP | 4.01 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |