C22H22F11N — CID 87882833
N-ethyl-2-methylpentan-1-amine;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-methyl-6-(trifluoromethyl)phenyl]benzene (PubChem CID 87882833) has the molecular formula C22H22F11N and a molecular weight of 509.40 g/mol. Its IUPAC name is N-ethyl-2-methylpentan-1-amine;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-methyl-6-(trifluoromethyl)phenyl]benzene.
| Compound Name | N-ethyl-2-methylpentan-1-amine;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-methyl-6-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 87882833 |
| Molecular Formula | C22H22F11N |
| Molecular Weight | 509.40 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | N-ethyl-2-methylpentan-1-amine;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-methyl-6-(trifluoromethyl)phenyl]benzene |
| SMILES | CCCC(C)CNCC.Cc1c(F)c(F)c(F)c(C(F)(F)F)c1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H3F11.C8H19N/c1-2-3(4-7(16)11(20)13(22)12(21)8(4)17)5(14(23,24)25)9(18)10(19)6(2)15;1-4-6-8(3)7-9-5-2/h1H3;8-9H,4-7H2,1-3H3 |
| InChIKey | PHRLBWFYPGTJKC-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.40 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|