C11H13F6N — CID 87882835
1-fluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-propylcyclohexa-2,4-dien-1-amine (PubChem CID 87882835) has the molecular formula C11H13F6N and a molecular weight of 273.22 g/mol. Its IUPAC name is 1-fluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-propylcyclohexa-2,4-dien-1-amine.
| Compound Name | 1-fluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-propylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 87882835 |
| Molecular Formula | C11H13F6N |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 1-fluoro-N-(1,1,2,2,2-pentafluoroethyl)-N-propylcyclohexa-2,4-dien-1-amine |
| SMILES | CCCN(C1(F)C=CC=CC1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H13F6N/c1-2-8-18(11(16,17)10(13,14)15)9(12)6-4-3-5-7-9/h3-6H,2,7-8H2,1H3 |
| InChIKey | MZNBIGAAGMMWRD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|