C22H17F16P — CID 87882836
1,1,2,2,3,3-hexafluorononyl(methyl)phosphane;1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)benzene (PubChem CID 87882836) has the molecular formula C22H17F16P and a molecular weight of 616.32 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluorononyl(methyl)phosphane;1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)benzene.
| Compound Name | 1,1,2,2,3,3-hexafluorononyl(methyl)phosphane;1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)benzene |
|---|---|
| PubChem CID | 87882836 |
| Molecular Formula | C22H17F16P |
| Molecular Weight | 616.32 g/mol |
| Exact Mass | 616.08 |
| IUPAC Name | 1,1,2,2,3,3-hexafluorononyl(methyl)phosphane;1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)benzene |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(F)PC.Fc1c(F)c(F)c(-c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C12F10.C10H17F6P/c13-3-1(4(14)8(18)11(21)7(3)17)2-5(15)9(19)12(22)10(20)6(2)16;1-3-4-5-6-7-8(11,12)9(13,14)10(15,16)17-2/h;17H,3-7H2,1-2H3 |
| InChIKey | DIPXAGOILAKZQO-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.32 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|