C30H27F22N — CID 87882846
1,1,2,2,3,3-hexafluoro-N-(2-methylpentyl)nonan-1-amine;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)phenyl]benzene (PubChem CID 87882846) has the molecular formula C30H27F22N and a molecular weight of 819.51 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-N-(2-methylpentyl)nonan-1-amine;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)phenyl]benzene.
| Compound Name | 1,1,2,2,3,3-hexafluoro-N-(2-methylpentyl)nonan-1-amine;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 87882846 |
| Molecular Formula | C30H27F22N |
| Molecular Weight | 819.51 g/mol |
| Exact Mass | 819.18 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-N-(2-methylpentyl)nonan-1-amine;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)phenyl]benzene |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(F)NCC(C)CCC.Fc1c(F)c(F)c(-c2c(C(F)(F)F)c(F)c(F)c(F)c2C(F)(F)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C15F16.C15H27F6N/c16-5-2(6(17)10(21)12(23)9(5)20)1-3(13(24,25)15(29,30)31)7(18)11(22)8(19)4(1)14(26,27)28;1-4-6-7-8-10-13(16,17)14(18,19)15(20,21)22-11-12(3)9-5-2/h;12,22H,4-11H2,1-3H3 |
| InChIKey | GSZQTMSHHBSVSE-UHFFFAOYSA-N |
| XLogP | 12.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.51 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|