C14H19F6N — CID 87882851
1-fluoro-N-(2-methylpentyl)-N-(1,1,2,2,2-pentafluoroethyl)cyclohexa-2,4-dien-1-amine (PubChem CID 87882851) has the molecular formula C14H19F6N and a molecular weight of 315.30 g/mol. Its IUPAC name is 1-fluoro-N-(2-methylpentyl)-N-(1,1,2,2,2-pentafluoroethyl)cyclohexa-2,4-dien-1-amine.
| Compound Name | 1-fluoro-N-(2-methylpentyl)-N-(1,1,2,2,2-pentafluoroethyl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 87882851 |
| Molecular Formula | C14H19F6N |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1-fluoro-N-(2-methylpentyl)-N-(1,1,2,2,2-pentafluoroethyl)cyclohexa-2,4-dien-1-amine |
| SMILES | CCCC(C)CN(C1(F)C=CC=CC1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H19F6N/c1-3-7-11(2)10-21(14(19,20)13(16,17)18)12(15)8-5-4-6-9-12/h4-6,8,11H,3,7,9-10H2,1-2H3 |
| InChIKey | VFZWZNVMZWIAEE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|