C20H8F21N — CID 87882863
N-(1,1,2,2,2-pentafluoroethyl)propan-1-amine;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)phenyl]benzene (PubChem CID 87882863) has the molecular formula C20H8F21N and a molecular weight of 661.25 g/mol. Its IUPAC name is N-(1,1,2,2,2-pentafluoroethyl)propan-1-amine;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)phenyl]benzene.
| Compound Name | N-(1,1,2,2,2-pentafluoroethyl)propan-1-amine;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 87882863 |
| Molecular Formula | C20H8F21N |
| Molecular Weight | 661.25 g/mol |
| Exact Mass | 661.03 |
| IUPAC Name | N-(1,1,2,2,2-pentafluoroethyl)propan-1-amine;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)phenyl]benzene |
| SMILES | CCCNC(F)(F)C(F)(F)F.Fc1c(F)c(F)c(-c2c(C(F)(F)F)c(F)c(F)c(F)c2C(F)(F)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C15F16.C5H8F5N/c16-5-2(6(17)10(21)12(23)9(5)20)1-3(13(24,25)15(29,30)31)7(18)11(22)8(19)4(1)14(26,27)28;1-2-3-11-5(9,10)4(6,7)8/h;11H,2-3H2,1H3 |
| InChIKey | XACDRYMAYAJLGH-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.25 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|