C17H25F6N — CID 87882976
1-fluoro-N-nonyl-N-(1,1,2,2,2-pentafluoroethyl)cyclohexa-2,4-dien-1-amine (PubChem CID 87882976) has the molecular formula C17H25F6N and a molecular weight of 357.38 g/mol. Its IUPAC name is 1-fluoro-N-nonyl-N-(1,1,2,2,2-pentafluoroethyl)cyclohexa-2,4-dien-1-amine.
| Compound Name | 1-fluoro-N-nonyl-N-(1,1,2,2,2-pentafluoroethyl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 87882976 |
| Molecular Formula | C17H25F6N |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 1-fluoro-N-nonyl-N-(1,1,2,2,2-pentafluoroethyl)cyclohexa-2,4-dien-1-amine |
| SMILES | CCCCCCCCCN(C1(F)C=CC=CC1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H25F6N/c1-2-3-4-5-6-7-11-14-24(17(22,23)16(19,20)21)15(18)12-9-8-10-13-15/h8-10,12H,2-7,11,13-14H2,1H3 |
| InChIKey | LETLMGPQXJVJOY-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|