C16H19F8N — CID 87883052
2,5-difluoro-N-(1,1,2,9,9,9-hexafluorononyl)-N-methylaniline (PubChem CID 87883052) has the molecular formula C16H19F8N and a molecular weight of 377.32 g/mol. Its IUPAC name is 2,5-difluoro-N-(1,1,2,9,9,9-hexafluorononyl)-N-methylaniline.
| Compound Name | 2,5-difluoro-N-(1,1,2,9,9,9-hexafluorononyl)-N-methylaniline |
|---|---|
| PubChem CID | 87883052 |
| Molecular Formula | C16H19F8N |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2,5-difluoro-N-(1,1,2,9,9,9-hexafluorononyl)-N-methylaniline |
| SMILES | CN(c1cc(F)ccc1F)C(F)(F)C(F)CCCCCCC(F)(F)F |
| InChI | InChI=1S/C16H19F8N/c1-25(13-10-11(17)7-8-12(13)18)16(23,24)14(19)6-4-2-3-5-9-15(20,21)22/h7-8,10,14H,2-6,9H2,1H3 |
| InChIKey | PLTUVKHRVBTPCW-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|