C27H27F16N — CID 87883057
1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)phenyl]benzene;N-propylnonan-1-amine (PubChem CID 87883057) has the molecular formula C27H27F16N and a molecular weight of 669.49 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)phenyl]benzene;N-propylnonan-1-amine.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)phenyl]benzene;N-propylnonan-1-amine |
|---|---|
| PubChem CID | 87883057 |
| Molecular Formula | C27H27F16N |
| Molecular Weight | 669.49 g/mol |
| Exact Mass | 669.19 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)phenyl]benzene;N-propylnonan-1-amine |
| SMILES | CCCCCCCCCNCCC.Fc1c(F)c(F)c(-c2c(C(F)(F)F)c(F)c(F)c(F)c2C(F)(F)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C15F16.C12H27N/c16-5-2(6(17)10(21)12(23)9(5)20)1-3(13(24,25)15(29,30)31)7(18)11(22)8(19)4(1)14(26,27)28;1-3-5-6-7-8-9-10-12-13-11-4-2/h;13H,3-12H2,1-2H3 |
| InChIKey | VOGHZNCSABAPAO-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.49 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|