C16HF20P — CID 87883077
bis(1,1,2,2,2-pentafluoroethyl)phosphane;1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)benzene (PubChem CID 87883077) has the molecular formula C16HF20P and a molecular weight of 604.12 g/mol. Its IUPAC name is bis(1,1,2,2,2-pentafluoroethyl)phosphane;1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)benzene.
| Compound Name | bis(1,1,2,2,2-pentafluoroethyl)phosphane;1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)benzene |
|---|---|
| PubChem CID | 87883077 |
| Molecular Formula | C16HF20P |
| Molecular Weight | 604.12 g/mol |
| Exact Mass | 603.95 |
| IUPAC Name | bis(1,1,2,2,2-pentafluoroethyl)phosphane;1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)benzene |
| SMILES | FC(F)(F)C(F)(F)PC(F)(F)C(F)(F)F.Fc1c(F)c(F)c(-c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C12F10.C4HF10P/c13-3-1(4(14)8(18)11(21)7(3)17)2-5(15)9(19)12(22)10(20)6(2)16;5-1(6,7)3(11,12)15-4(13,14)2(8,9)10/h;15H |
| InChIKey | CGLOFFSZAYPDNB-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.12 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|