C16H9F12P — CID 87883108
fluoromethyl(methyl)phosphane;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-methyl-6-(trifluoromethyl)phenyl]benzene (PubChem CID 87883108) has the molecular formula C16H9F12P and a molecular weight of 460.20 g/mol. Its IUPAC name is fluoromethyl(methyl)phosphane;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-methyl-6-(trifluoromethyl)phenyl]benzene.
| Compound Name | fluoromethyl(methyl)phosphane;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-methyl-6-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 87883108 |
| Molecular Formula | C16H9F12P |
| Molecular Weight | 460.20 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | fluoromethyl(methyl)phosphane;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-methyl-6-(trifluoromethyl)phenyl]benzene |
| SMILES | CPCF.Cc1c(F)c(F)c(F)c(C(F)(F)F)c1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H3F11.C2H6FP/c1-2-3(4-7(16)11(20)13(22)12(21)8(4)17)5(14(23,24)25)9(18)10(19)6(2)15;1-4-2-3/h1H3;4H,2H2,1H3 |
| InChIKey | KXOQRKMUUAWAGQ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.20 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|