C15H12F7N — CID 87883131
N-(fluoromethyl)ethanamine;1,2,3,4,5-pentafluoro-6-(2-fluorophenyl)benzene (PubChem CID 87883131) has the molecular formula C15H12F7N and a molecular weight of 339.25 g/mol. Its IUPAC name is N-(fluoromethyl)ethanamine;1,2,3,4,5-pentafluoro-6-(2-fluorophenyl)benzene.
| Compound Name | N-(fluoromethyl)ethanamine;1,2,3,4,5-pentafluoro-6-(2-fluorophenyl)benzene |
|---|---|
| PubChem CID | 87883131 |
| Molecular Formula | C15H12F7N |
| Molecular Weight | 339.25 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-(fluoromethyl)ethanamine;1,2,3,4,5-pentafluoro-6-(2-fluorophenyl)benzene |
| SMILES | CCNCF.Fc1ccccc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H4F6.C3H8FN/c13-6-4-2-1-3-5(6)7-8(14)10(16)12(18)11(17)9(7)15;1-2-5-3-4/h1-4H;5H,2-3H2,1H3 |
| InChIKey | LBSAOVSWKAPFKN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.25 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|