C24H23NO5S — CID 87883215
1-(benzenesulfonyl)-6-(1H-indol-3-yl)-4,6-dimethoxy-5-methylcyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 87883215) has the molecular formula C24H23NO5S and a molecular weight of 437.52 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-6-(1H-indol-3-yl)-4,6-dimethoxy-5-methylcyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 1-(benzenesulfonyl)-6-(1H-indol-3-yl)-4,6-dimethoxy-5-methylcyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 87883215 |
| Molecular Formula | C24H23NO5S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 1-(benzenesulfonyl)-6-(1H-indol-3-yl)-4,6-dimethoxy-5-methylcyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | COC1=C(C)C(OC)(c2c[nH]c3ccccc23)C(C=O)(S(=O)(=O)c2ccccc2)C=C1 |
| InChI | InChI=1S/C24H23NO5S/c1-17-22(29-2)13-14-23(16-26,31(27,28)18-9-5-4-6-10-18)24(17,30-3)20-15-25-21-12-8-7-11-19(20)21/h4-16,25H,1-3H3 |
| InChIKey | SMCUGSSEDDLZDB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|