About ethane-1,2-diol;bis(oxirane-2-carboxylic acid)
ethane-1,2-diol;bis(oxirane-2-carboxylic acid) (PubChem CID 87883569) has the molecular formula C8H14O8
and a molecular weight of 238.19 g/mol. Its IUPAC name is ethane-1,2-diol;bis(oxirane-2-carboxylic acid).
Molecular Properties
| Compound Name | ethane-1,2-diol;bis(oxirane-2-carboxylic acid) |
| PubChem CID | 87883569 |
| Molecular Formula | C8H14O8 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | ethane-1,2-diol;bis(oxirane-2-carboxylic acid) |
| SMILES | O=C(O)C1CO1.O=C(O)C1CO1.OCCO |
| InChI | InChI=1S/2C3H4O3.C2H6O2/c2*4-3(5)2-1-6-2;3-1-2-4/h2*2H,1H2,(H,4,5);3-4H,1-2H2 |
| InChIKey | WZHVCMKFRRSZKK-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 140.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,2-diol;bis(oxirane-2-carboxylic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;bis(oxirane-2-carboxylic acid)?
The IUPAC name of ethane-1,2-diol;bis(oxirane-2-carboxylic acid) (CID 87883569) is ethane-1,2-diol;bis(oxirane-2-carboxylic acid).
What is the SMILES notation for ethane-1,2-diol;bis(oxirane-2-carboxylic acid)?
The canonical SMILES for ethane-1,2-diol;bis(oxirane-2-carboxylic acid) is O=C(O)C1CO1.O=C(O)C1CO1.OCCO.
What is the InChIKey of ethane-1,2-diol;bis(oxirane-2-carboxylic acid)?
The InChIKey is WZHVCMKFRRSZKK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H4O3.C2H6O2/c2*4-3(5)2-1-6-2;3-1-2-4/h2*2H,1H2,(H,4,5);3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;bis(oxirane-2-carboxylic acid)?
ethane-1,2-diol;bis(oxirane-2-carboxylic acid) has a molecular weight of 238.19 g/mol, XLogP of -2.09, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;bis(oxirane-2-carboxylic acid) is sourced from PubChem (CID 87883569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).