About CID 87883645
CID 87883645 (PubChem CID 87883645) has the molecular formula C12H19BrNOSi
and a molecular weight of 301.28 g/mol.
Molecular Properties
| Compound Name | CID 87883645 |
| PubChem CID | 87883645 |
| Molecular Formula | C12H19BrNOSi |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | — |
| SMILES | C[Si](C)OC(c1cccc(Br)n1)C(C)(C)C |
| InChI | InChI=1S/C12H19BrNOSi/c1-12(2,3)11(15-16(4)5)9-7-6-8-10(13)14-9/h6-8,11H,1-5H3 |
| InChIKey | SBUIGGXIUQIVGV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87883645 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87883645?
The IUPAC name of CID 87883645 (CID 87883645) is not available.
What is the SMILES notation for CID 87883645?
The canonical SMILES for CID 87883645 is C[Si](C)OC(c1cccc(Br)n1)C(C)(C)C.
What is the InChIKey of CID 87883645?
The InChIKey is SBUIGGXIUQIVGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19BrNOSi/c1-12(2,3)11(15-16(4)5)9-7-6-8-10(13)14-9/h6-8,11H,1-5H3.
What are the key properties of CID 87883645?
CID 87883645 has a molecular weight of 301.28 g/mol, XLogP of 4.20, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87883645 is sourced from PubChem (CID 87883645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).