About 5-bromopyrimidine;4-pyrimidin-5-ylbenzaldehyde
5-bromopyrimidine;4-pyrimidin-5-ylbenzaldehyde (PubChem CID 87883729) has the molecular formula C15H11BrN4O
and a molecular weight of 343.18 g/mol. Its IUPAC name is 5-bromopyrimidine;4-pyrimidin-5-ylbenzaldehyde.
Molecular Properties
| Compound Name | 5-bromopyrimidine;4-pyrimidin-5-ylbenzaldehyde |
| PubChem CID | 87883729 |
| Molecular Formula | C15H11BrN4O |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 5-bromopyrimidine;4-pyrimidin-5-ylbenzaldehyde |
| SMILES | Brc1cncnc1.O=Cc1ccc(-c2cncnc2)cc1 |
| InChI | InChI=1S/C11H8N2O.C4H3BrN2/c14-7-9-1-3-10(4-2-9)11-5-12-8-13-6-11;5-4-1-6-3-7-2-4/h1-8H;1-3H |
| InChIKey | LMOCAAGGZVZJRB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-bromopyrimidine;4-pyrimidin-5-ylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromopyrimidine;4-pyrimidin-5-ylbenzaldehyde?
The IUPAC name of 5-bromopyrimidine;4-pyrimidin-5-ylbenzaldehyde (CID 87883729) is 5-bromopyrimidine;4-pyrimidin-5-ylbenzaldehyde.
What is the SMILES notation for 5-bromopyrimidine;4-pyrimidin-5-ylbenzaldehyde?
The canonical SMILES for 5-bromopyrimidine;4-pyrimidin-5-ylbenzaldehyde is Brc1cncnc1.O=Cc1ccc(-c2cncnc2)cc1.
What is the InChIKey of 5-bromopyrimidine;4-pyrimidin-5-ylbenzaldehyde?
The InChIKey is LMOCAAGGZVZJRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O.C4H3BrN2/c14-7-9-1-3-10(4-2-9)11-5-12-8-13-6-11;5-4-1-6-3-7-2-4/h1-8H;1-3H.
What are the key properties of 5-bromopyrimidine;4-pyrimidin-5-ylbenzaldehyde?
5-bromopyrimidine;4-pyrimidin-5-ylbenzaldehyde has a molecular weight of 343.18 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromopyrimidine;4-pyrimidin-5-ylbenzaldehyde is sourced from PubChem (CID 87883729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).