C24H20Cl2N4O7S — CID 87883767
3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[[(4R,5R)-5-(1,3-thiazol-2-ylcarbamoyl)-1,3-dioxolane-4-carbonyl]amino]propanoic acid (PubChem CID 87883767) has the molecular formula C24H20Cl2N4O7S and a molecular weight of 579.42 g/mol. Its IUPAC name is 3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[[(4R,5R)-5-(1,3-thiazol-2-ylcarbamoyl)-1,3-dioxolane-4-carbonyl]amino]propanoic acid.
| Compound Name | 3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[[(4R,5R)-5-(1,3-thiazol-2-ylcarbamoyl)-1,3-dioxolane-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 87883767 |
| Molecular Formula | C24H20Cl2N4O7S |
| Molecular Weight | 579.42 g/mol |
| Exact Mass | 578.04 |
| IUPAC Name | 3-[4-[(2,6-dichlorobenzoyl)amino]phenyl]-2-[[(4R,5R)-5-(1,3-thiazol-2-ylcarbamoyl)-1,3-dioxolane-4-carbonyl]amino]propanoic acid |
| SMILES | O=C(Nc1ccc(CC(NC(=O)[C@@H]2OCO[C@H]2C(=O)Nc2nccs2)C(=O)O)cc1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H20Cl2N4O7S/c25-14-2-1-3-15(26)17(14)20(31)28-13-6-4-12(5-7-13)10-16(23(34)35)29-21(32)18-19(37-11-36-18)22(33)30-24-27-8-9-38-24/h1-9,16,18-19H,10-11H2,(H,28,31)(H,29,32)(H,34,35)(H,27,30,33)/t16?,18-,19-/m1/s1 |
| InChIKey | CFSFRCCQQLPAIB-VOBHOPKGSA-N |
| XLogP | 3.19 |
| TPSA | 155.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |