C21H22N2O3S — CID 87883842
S-[4-[4-(1,3-dioxoisoindol-4-yl)butyl]phenyl] N,N-dimethylcarbamothioate (PubChem CID 87883842) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is S-[4-[4-(1,3-dioxoisoindol-4-yl)butyl]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[4-(1,3-dioxoisoindol-4-yl)butyl]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 87883842 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | S-[4-[4-(1,3-dioxoisoindol-4-yl)butyl]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc(CCCCc2cccc3c2C(=O)NC3=O)cc1 |
| InChI | InChI=1S/C21H22N2O3S/c1-23(2)21(26)27-16-12-10-14(11-13-16)6-3-4-7-15-8-5-9-17-18(15)20(25)22-19(17)24/h5,8-13H,3-4,6-7H2,1-2H3,(H,22,24,25) |
| InChIKey | TYPFBUOCQHEENZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|