C15H11F5N2O2 — CID 87883878
(2,3,4,5,6-pentafluorophenyl) N-ethyl-N-(2-methyl-4-pyridinyl)carbamate (PubChem CID 87883878) has the molecular formula C15H11F5N2O2 and a molecular weight of 346.26 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) N-ethyl-N-(2-methyl-4-pyridinyl)carbamate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) N-ethyl-N-(2-methyl-4-pyridinyl)carbamate |
|---|---|
| PubChem CID | 87883878 |
| Molecular Formula | C15H11F5N2O2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) N-ethyl-N-(2-methyl-4-pyridinyl)carbamate |
| SMILES | CCN(C(=O)Oc1c(F)c(F)c(F)c(F)c1F)c1ccnc(C)c1 |
| InChI | InChI=1S/C15H11F5N2O2/c1-3-22(8-4-5-21-7(2)6-8)15(23)24-14-12(19)10(17)9(16)11(18)13(14)20/h4-6H,3H2,1-2H3 |
| InChIKey | VLTSUCFDXGKGCY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|