C13H9N5 — CID 878844
9,13,14,16-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,11,14,16-octaen-12-amine (PubChem CID 878844) has the molecular formula C13H9N5 and a molecular weight of 235.25 g/mol. Its IUPAC name is 9,13,14,16-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,11,14,16-octaen-12-amine.
| Compound Name | 9,13,14,16-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,11,14,16-octaen-12-amine |
|---|---|
| PubChem CID | 878844 |
| Molecular Formula | C13H9N5 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 9,13,14,16-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9,11,14,16-octaen-12-amine |
| SMILES | Nc1[nH]nc2ncc3cc4ccccc4nc3c12 |
| InChI | InChI=1S/C13H9N5/c14-12-10-11-8(6-15-13(10)18-17-12)5-7-3-1-2-4-9(7)16-11/h1-6H,(H3,14,15,17,18) |
| InChIKey | QGZFKVBYBREHFD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|