About 7-propoxy-2,3-dihydro-1H-indene-1-carbaldehyde
7-propoxy-2,3-dihydro-1H-indene-1-carbaldehyde (PubChem CID 87884769) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is 7-propoxy-2,3-dihydro-1H-indene-1-carbaldehyde.
Molecular Properties
| Compound Name | 7-propoxy-2,3-dihydro-1H-indene-1-carbaldehyde |
| PubChem CID | 87884769 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 7-propoxy-2,3-dihydro-1H-indene-1-carbaldehyde |
| SMILES | CCCOc1cccc2c1C(C=O)CC2 |
| InChI | InChI=1S/C13H16O2/c1-2-8-15-12-5-3-4-10-6-7-11(9-14)13(10)12/h3-5,9,11H,2,6-8H2,1H3 |
| InChIKey | CKBNJFISPNLPEO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7-propoxy-2,3-dihydro-1H-indene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propoxy-2,3-dihydro-1H-indene-1-carbaldehyde?
The IUPAC name of 7-propoxy-2,3-dihydro-1H-indene-1-carbaldehyde (CID 87884769) is 7-propoxy-2,3-dihydro-1H-indene-1-carbaldehyde.
What is the SMILES notation for 7-propoxy-2,3-dihydro-1H-indene-1-carbaldehyde?
The canonical SMILES for 7-propoxy-2,3-dihydro-1H-indene-1-carbaldehyde is CCCOc1cccc2c1C(C=O)CC2.
What is the InChIKey of 7-propoxy-2,3-dihydro-1H-indene-1-carbaldehyde?
The InChIKey is CKBNJFISPNLPEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c1-2-8-15-12-5-3-4-10-6-7-11(9-14)13(10)12/h3-5,9,11H,2,6-8H2,1H3.
What are the key properties of 7-propoxy-2,3-dihydro-1H-indene-1-carbaldehyde?
7-propoxy-2,3-dihydro-1H-indene-1-carbaldehyde has a molecular weight of 204.27 g/mol, XLogP of 2.70, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propoxy-2,3-dihydro-1H-indene-1-carbaldehyde is sourced from PubChem (CID 87884769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).