About 2-[(2-phenyl-2,3-dihydro-1,4-benzodioxin-6-yl)oxy]-5-(trifluoromethyl)pyridine
2-[(2-phenyl-2,3-dihydro-1,4-benzodioxin-6-yl)oxy]-5-(trifluoromethyl)pyridine (PubChem CID 87884878) has the molecular formula C40H28F6N2O6
and a molecular weight of 746.66 g/mol. Its IUPAC name is 2-[(2-phenyl-2,3-dihydro-1,4-benzodioxin-6-yl)oxy]-5-(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | 2-[(2-phenyl-2,3-dihydro-1,4-benzodioxin-6-yl)oxy]-5-(trifluoromethyl)pyridine |
| PubChem CID | 87884878 |
| Molecular Formula | C40H28F6N2O6 |
| Molecular Weight | 746.66 g/mol |
| Exact Mass | 746.19 |
| IUPAC Name | 2-[(2-phenyl-2,3-dihydro-1,4-benzodioxin-6-yl)oxy]-5-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1ccc(Oc2ccc3c(c2)OCC(c2ccccc2)O3)nc1.FC(F)(F)c1ccc(Oc2ccc3c(c2)OCC(c2ccccc2)O3)nc1 |
| InChI | InChI=1S/2C20H14F3NO3/c2*21-20(22,23)14-6-9-19(24-11-14)26-15-7-8-16-17(10-15)25-12-18(27-16)13-4-2-1-3-5-13/h2*1-11,18H,12H2 |
| InChIKey | BCOANJFAZYBJOU-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 746.66 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[(2-phenyl-2,3-dihydro-1,4-benzodioxin-6-yl)oxy]-5-(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-phenyl-2,3-dihydro-1,4-benzodioxin-6-yl)oxy]-5-(trifluoromethyl)pyridine?
The IUPAC name of 2-[(2-phenyl-2,3-dihydro-1,4-benzodioxin-6-yl)oxy]-5-(trifluoromethyl)pyridine (CID 87884878) is 2-[(2-phenyl-2,3-dihydro-1,4-benzodioxin-6-yl)oxy]-5-(trifluoromethyl)pyridine.
What is the SMILES notation for 2-[(2-phenyl-2,3-dihydro-1,4-benzodioxin-6-yl)oxy]-5-(trifluoromethyl)pyridine?
The canonical SMILES for 2-[(2-phenyl-2,3-dihydro-1,4-benzodioxin-6-yl)oxy]-5-(trifluoromethyl)pyridine is FC(F)(F)c1ccc(Oc2ccc3c(c2)OCC(c2ccccc2)O3)nc1.FC(F)(F)c1ccc(Oc2ccc3c(c2)OCC(c2ccccc2)O3)nc1.
What is the InChIKey of 2-[(2-phenyl-2,3-dihydro-1,4-benzodioxin-6-yl)oxy]-5-(trifluoromethyl)pyridine?
The InChIKey is BCOANJFAZYBJOU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C20H14F3NO3/c2*21-20(22,23)14-6-9-19(24-11-14)26-15-7-8-16-17(10-15)25-12-18(27-16)13-4-2-1-3-5-13/h2*1-11,18H,12H2.
What are the key properties of 2-[(2-phenyl-2,3-dihydro-1,4-benzodioxin-6-yl)oxy]-5-(trifluoromethyl)pyridine?
2-[(2-phenyl-2,3-dihydro-1,4-benzodioxin-6-yl)oxy]-5-(trifluoromethyl)pyridine has a molecular weight of 746.66 g/mol, XLogP of 10.81, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-phenyl-2,3-dihydro-1,4-benzodioxin-6-yl)oxy]-5-(trifluoromethyl)pyridine is sourced from PubChem (CID 87884878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).