About 5-acetyloxy-2-hydroxy-2,5-dimethyl-3-oxohexanoic acid
5-acetyloxy-2-hydroxy-2,5-dimethyl-3-oxohexanoic acid (PubChem CID 87885234) has the molecular formula C10H16O6
and a molecular weight of 232.23 g/mol. Its IUPAC name is 5-acetyloxy-2-hydroxy-2,5-dimethyl-3-oxohexanoic acid.
Molecular Properties
| Compound Name | 5-acetyloxy-2-hydroxy-2,5-dimethyl-3-oxohexanoic acid |
| PubChem CID | 87885234 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 5-acetyloxy-2-hydroxy-2,5-dimethyl-3-oxohexanoic acid |
| SMILES | CC(=O)OC(C)(C)CC(=O)C(C)(O)C(=O)O |
| InChI | InChI=1S/C10H16O6/c1-6(11)16-9(2,3)5-7(12)10(4,15)8(13)14/h15H,5H2,1-4H3,(H,13,14) |
| InChIKey | QFNNFKJYASLMOV-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-acetyloxy-2-hydroxy-2,5-dimethyl-3-oxohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyloxy-2-hydroxy-2,5-dimethyl-3-oxohexanoic acid?
The IUPAC name of 5-acetyloxy-2-hydroxy-2,5-dimethyl-3-oxohexanoic acid (CID 87885234) is 5-acetyloxy-2-hydroxy-2,5-dimethyl-3-oxohexanoic acid.
What is the SMILES notation for 5-acetyloxy-2-hydroxy-2,5-dimethyl-3-oxohexanoic acid?
The canonical SMILES for 5-acetyloxy-2-hydroxy-2,5-dimethyl-3-oxohexanoic acid is CC(=O)OC(C)(C)CC(=O)C(C)(O)C(=O)O.
What is the InChIKey of 5-acetyloxy-2-hydroxy-2,5-dimethyl-3-oxohexanoic acid?
The InChIKey is QFNNFKJYASLMOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O6/c1-6(11)16-9(2,3)5-7(12)10(4,15)8(13)14/h15H,5H2,1-4H3,(H,13,14).
What are the key properties of 5-acetyloxy-2-hydroxy-2,5-dimethyl-3-oxohexanoic acid?
5-acetyloxy-2-hydroxy-2,5-dimethyl-3-oxohexanoic acid has a molecular weight of 232.23 g/mol, XLogP of 0.12, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyloxy-2-hydroxy-2,5-dimethyl-3-oxohexanoic acid is sourced from PubChem (CID 87885234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).