C48H36O12 — CID 87885278
2-(4-hydroxy-6,8-dimethyl-2-oxochromen-3-yl)-6,8-dimethylfuro[3,2-c]chromen-4-one;2-(4-hydroxy-7,8-dimethyl-2-oxochromen-3-yl)-6,7-dimethylfuro[3,2-c]chromen-4-one (PubChem CID 87885278) has the molecular formula C48H36O12 and a molecular weight of 804.80 g/mol. Its IUPAC name is 2-(4-hydroxy-6,8-dimethyl-2-oxochromen-3-yl)-6,8-dimethylfuro[3,2-c]chromen-4-one;2-(4-hydroxy-7,8-dimethyl-2-oxochromen-3-yl)-6,7-dimethylfuro[3,2-c]chromen-4-one.
| Compound Name | 2-(4-hydroxy-6,8-dimethyl-2-oxochromen-3-yl)-6,8-dimethylfuro[3,2-c]chromen-4-one;2-(4-hydroxy-7,8-dimethyl-2-oxochromen-3-yl)-6,7-dimethylfuro[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 87885278 |
| Molecular Formula | C48H36O12 |
| Molecular Weight | 804.80 g/mol |
| Exact Mass | 804.22 |
| IUPAC Name | 2-(4-hydroxy-6,8-dimethyl-2-oxochromen-3-yl)-6,8-dimethylfuro[3,2-c]chromen-4-one;2-(4-hydroxy-7,8-dimethyl-2-oxochromen-3-yl)-6,7-dimethylfuro[3,2-c]chromen-4-one |
| SMILES | Cc1cc(C)c2oc(=O)c(-c3cc4c(=O)oc5c(C)cc(C)cc5c4o3)c(O)c2c1.Cc1ccc2c(O)c(-c3cc4c(=O)oc5c(C)c(C)ccc5c4o3)c(=O)oc2c1C |
| InChI | InChI=1S/2C24H18O6/c1-10-5-12(3)20-14(7-10)19(25)18(24(27)30-20)17-9-16-22(28-17)15-8-11(2)6-13(4)21(15)29-23(16)26;1-10-5-7-14-19(25)18(24(27)30-20(14)12(10)3)17-9-16-22(28-17)15-8-6-11(2)13(4)21(15)29-23(16)26/h2*5-9,25H,1-4H3 |
| InChIKey | WYJJMIWIQIOIEF-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 187.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.80 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|