About phosphoroso-[2-(2,4,6-trimethylphenyl)phenyl]methanone
phosphoroso-[2-(2,4,6-trimethylphenyl)phenyl]methanone (PubChem CID 87885777) has the molecular formula C16H15O2P
and a molecular weight of 270.27 g/mol. Its IUPAC name is phosphoroso-[2-(2,4,6-trimethylphenyl)phenyl]methanone.
Molecular Properties
| Compound Name | phosphoroso-[2-(2,4,6-trimethylphenyl)phenyl]methanone |
| PubChem CID | 87885777 |
| Molecular Formula | C16H15O2P |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | phosphoroso-[2-(2,4,6-trimethylphenyl)phenyl]methanone |
| SMILES | Cc1cc(C)c(-c2ccccc2C(=O)P=O)c(C)c1 |
| InChI | InChI=1S/C16H15O2P/c1-10-8-11(2)15(12(3)9-10)13-6-4-5-7-14(13)16(17)19-18/h4-9H,1-3H3 |
| InChIKey | ZLSHDTWNJIVHLZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphoroso-[2-(2,4,6-trimethylphenyl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphoroso-[2-(2,4,6-trimethylphenyl)phenyl]methanone?
The IUPAC name of phosphoroso-[2-(2,4,6-trimethylphenyl)phenyl]methanone (CID 87885777) is phosphoroso-[2-(2,4,6-trimethylphenyl)phenyl]methanone.
What is the SMILES notation for phosphoroso-[2-(2,4,6-trimethylphenyl)phenyl]methanone?
The canonical SMILES for phosphoroso-[2-(2,4,6-trimethylphenyl)phenyl]methanone is Cc1cc(C)c(-c2ccccc2C(=O)P=O)c(C)c1.
What is the InChIKey of phosphoroso-[2-(2,4,6-trimethylphenyl)phenyl]methanone?
The InChIKey is ZLSHDTWNJIVHLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15O2P/c1-10-8-11(2)15(12(3)9-10)13-6-4-5-7-14(13)16(17)19-18/h4-9H,1-3H3.
What are the key properties of phosphoroso-[2-(2,4,6-trimethylphenyl)phenyl]methanone?
phosphoroso-[2-(2,4,6-trimethylphenyl)phenyl]methanone has a molecular weight of 270.27 g/mol, XLogP of 4.71, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phosphoroso-[2-(2,4,6-trimethylphenyl)phenyl]methanone is sourced from PubChem (CID 87885777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).