About 4-(5-bromo-2-pyridinyl)morpholine;2,5-dibromopyridine
4-(5-bromo-2-pyridinyl)morpholine;2,5-dibromopyridine (PubChem CID 87886252) has the molecular formula C14H14Br3N3O
and a molecular weight of 480.00 g/mol. Its IUPAC name is 4-(5-bromo-2-pyridinyl)morpholine;2,5-dibromopyridine.
Molecular Properties
| Compound Name | 4-(5-bromo-2-pyridinyl)morpholine;2,5-dibromopyridine |
| PubChem CID | 87886252 |
| Molecular Formula | C14H14Br3N3O |
| Molecular Weight | 480.00 g/mol |
| Exact Mass | 476.87 |
| IUPAC Name | 4-(5-bromo-2-pyridinyl)morpholine;2,5-dibromopyridine |
| SMILES | Brc1ccc(Br)nc1.Brc1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C9H11BrN2O.C5H3Br2N/c10-8-1-2-9(11-7-8)12-3-5-13-6-4-12;6-4-1-2-5(7)8-3-4/h1-2,7H,3-6H2;1-3H |
| InChIKey | JUMYLBNXEFWJCU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.00 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-bromo-2-pyridinyl)morpholine;2,5-dibromopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-bromo-2-pyridinyl)morpholine;2,5-dibromopyridine?
The IUPAC name of 4-(5-bromo-2-pyridinyl)morpholine;2,5-dibromopyridine (CID 87886252) is 4-(5-bromo-2-pyridinyl)morpholine;2,5-dibromopyridine.
What is the SMILES notation for 4-(5-bromo-2-pyridinyl)morpholine;2,5-dibromopyridine?
The canonical SMILES for 4-(5-bromo-2-pyridinyl)morpholine;2,5-dibromopyridine is Brc1ccc(Br)nc1.Brc1ccc(N2CCOCC2)nc1.
What is the InChIKey of 4-(5-bromo-2-pyridinyl)morpholine;2,5-dibromopyridine?
The InChIKey is JUMYLBNXEFWJCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrN2O.C5H3Br2N/c10-8-1-2-9(11-7-8)12-3-5-13-6-4-12;6-4-1-2-5(7)8-3-4/h1-2,7H,3-6H2;1-3H.
What are the key properties of 4-(5-bromo-2-pyridinyl)morpholine;2,5-dibromopyridine?
4-(5-bromo-2-pyridinyl)morpholine;2,5-dibromopyridine has a molecular weight of 480.00 g/mol, XLogP of 4.29, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-bromo-2-pyridinyl)morpholine;2,5-dibromopyridine is sourced from PubChem (CID 87886252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).