C22H29N3OS2 — CID 87886319
8-[(3S)-3-(2-methoxyethyl)-4-methylpiperazin-1-yl]-5-propyl-3,4-dithia-10-azatricyclo[7.5.0.02,7]tetradeca-1(14),2(7),5,8,10,12-hexaene (PubChem CID 87886319) has the molecular formula C22H29N3OS2 and a molecular weight of 415.63 g/mol. Its IUPAC name is 8-[(3S)-3-(2-methoxyethyl)-4-methylpiperazin-1-yl]-5-propyl-3,4-dithia-10-azatricyclo[7.5.0.02,7]tetradeca-1(14),2(7),5,8,10,12-hexaene.
| Compound Name | 8-[(3S)-3-(2-methoxyethyl)-4-methylpiperazin-1-yl]-5-propyl-3,4-dithia-10-azatricyclo[7.5.0.02,7]tetradeca-1(14),2(7),5,8,10,12-hexaene |
|---|---|
| PubChem CID | 87886319 |
| Molecular Formula | C22H29N3OS2 |
| Molecular Weight | 415.63 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 8-[(3S)-3-(2-methoxyethyl)-4-methylpiperazin-1-yl]-5-propyl-3,4-dithia-10-azatricyclo[7.5.0.02,7]tetradeca-1(14),2(7),5,8,10,12-hexaene |
| SMILES | CCCC1=Cc2c(c3ccccnc-3c2N2CCN(C)[C@@H](CCOC)C2)SS1 |
| InChI | InChI=1S/C22H29N3OS2/c1-4-7-17-14-19-21(25-12-11-24(2)16(15-25)9-13-26-3)20-18(22(19)28-27-17)8-5-6-10-23-20/h5-6,8,10,14,16H,4,7,9,11-13,15H2,1-3H3/t16-/m0/s1 |
| InChIKey | OZYGTRASJJYKDN-INIZCTEOSA-N |
| XLogP | 5.24 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|