C13H15FN2O2S — CID 87886541
(2S)-1-[(3-fluorophenyl)methylcarbamothioyl]pyrrolidine-2-carboxylic acid (PubChem CID 87886541) has the molecular formula C13H15FN2O2S and a molecular weight of 282.34 g/mol. Its IUPAC name is (2S)-1-[(3-fluorophenyl)methylcarbamothioyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(3-fluorophenyl)methylcarbamothioyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 87886541 |
| Molecular Formula | C13H15FN2O2S |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | (2S)-1-[(3-fluorophenyl)methylcarbamothioyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C(=S)NCc1cccc(F)c1 |
| InChI | InChI=1S/C13H15FN2O2S/c14-10-4-1-3-9(7-10)8-15-13(19)16-6-2-5-11(16)12(17)18/h1,3-4,7,11H,2,5-6,8H2,(H,15,19)(H,17,18)/t11-/m0/s1 |
| InChIKey | NQSQTAYPSNGCBF-NSHDSACASA-N |
| XLogP | 1.75 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|